C24H22N4O3S2 — CID 123671663
N-[4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-4-methyl-3-(1,6-naphthyridin-2-yl)aniline (PubChem CID 123671663) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-4-methyl-3-(1,6-naphthyridin-2-yl)aniline.
| Compound Name | N-[4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-4-methyl-3-(1,6-naphthyridin-2-yl)aniline |
|---|---|
| PubChem CID | 123671663 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-4-methyl-3-(1,6-naphthyridin-2-yl)aniline |
| SMILES | Cc1ccc(NSc2ccc(N3COCCS3(=O)=O)cc2)cc1-c1ccc2cnccc2n1 |
| InChI | InChI=1S/C24H22N4O3S2/c1-17-2-4-19(14-22(17)24-9-3-18-15-25-11-10-23(18)26-24)27-32-21-7-5-20(6-8-21)28-16-31-12-13-33(28,29)30/h2-11,14-15,27H,12-13,16H2,1H3 |
| InChIKey | XZZXGUAVSCISKL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|