C23H22N4OS2 — CID 144621454
4-methyl-3-(1,6-naphthyridin-2-yl)-N-[4-(1-oxothiazetidin-2-yl)cyclohexa-2,4-dien-1-yl]sulfanylaniline (PubChem CID 144621454) has the molecular formula C23H22N4OS2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 4-methyl-3-(1,6-naphthyridin-2-yl)-N-[4-(1-oxothiazetidin-2-yl)cyclohexa-2,4-dien-1-yl]sulfanylaniline.
| Compound Name | 4-methyl-3-(1,6-naphthyridin-2-yl)-N-[4-(1-oxothiazetidin-2-yl)cyclohexa-2,4-dien-1-yl]sulfanylaniline |
|---|---|
| PubChem CID | 144621454 |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-methyl-3-(1,6-naphthyridin-2-yl)-N-[4-(1-oxothiazetidin-2-yl)cyclohexa-2,4-dien-1-yl]sulfanylaniline |
| SMILES | Cc1ccc(NSC2C=CC(N3CCS3=O)=CC2)cc1-c1ccc2cnccc2n1 |
| InChI | InChI=1S/C23H22N4OS2/c1-16-2-4-18(14-21(16)23-9-3-17-15-24-11-10-22(17)25-23)26-29-20-7-5-19(6-8-20)27-12-13-30(27)28/h2-7,9-11,14-15,20,26H,8,12-13H2,1H3 |
| InChIKey | OMOBDCYYNBTFHY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|