C25H20FN3O4S — CID 118463109
4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)-2-fluoro-N-(3-quinolin-2-ylphenyl)benzamide (PubChem CID 118463109) has the molecular formula C25H20FN3O4S and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)-2-fluoro-N-(3-quinolin-2-ylphenyl)benzamide.
| Compound Name | 4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)-2-fluoro-N-(3-quinolin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 118463109 |
| Molecular Formula | C25H20FN3O4S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)-2-fluoro-N-(3-quinolin-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc3ccccc3n2)c1)c1ccc(N2COCCS2(=O)=O)cc1F |
| InChI | InChI=1S/C25H20FN3O4S/c26-22-15-20(29-16-33-12-13-34(29,31)32)9-10-21(22)25(30)27-19-6-3-5-18(14-19)24-11-8-17-4-1-2-7-23(17)28-24/h1-11,14-15H,12-13,16H2,(H,27,30) |
| InChIKey | QKEXKSBELLGTQD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |