C25H22FN5OS — CID 144621471
2-fluoro-4-(6-methyl-1,2,6-thiadiazinan-2-yl)-N-[3-(1,5-naphthyridin-2-yl)phenyl]benzamide (PubChem CID 144621471) has the molecular formula C25H22FN5OS and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-fluoro-4-(6-methyl-1,2,6-thiadiazinan-2-yl)-N-[3-(1,5-naphthyridin-2-yl)phenyl]benzamide.
| Compound Name | 2-fluoro-4-(6-methyl-1,2,6-thiadiazinan-2-yl)-N-[3-(1,5-naphthyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 144621471 |
| Molecular Formula | C25H22FN5OS |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-fluoro-4-(6-methyl-1,2,6-thiadiazinan-2-yl)-N-[3-(1,5-naphthyridin-2-yl)phenyl]benzamide |
| SMILES | CN1CCCN(c2ccc(C(=O)Nc3cccc(-c4ccc5ncccc5n4)c3)c(F)c2)S1 |
| InChI | InChI=1S/C25H22FN5OS/c1-30-13-4-14-31(33-30)19-8-9-20(21(26)16-19)25(32)28-18-6-2-5-17(15-18)22-10-11-23-24(29-22)7-3-12-27-23/h2-3,5-12,15-16H,4,13-14H2,1H3,(H,28,32) |
| InChIKey | PPWNCAKWMXPEJO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|