C26H23N3O3S — CID 90129813
4-(1,1-dioxothiazinan-2-yl)-N-(3-quinolin-2-ylphenyl)benzamide (PubChem CID 90129813) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-(3-quinolin-2-ylphenyl)benzamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-(3-quinolin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 90129813 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-(3-quinolin-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc3ccccc3n2)c1)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C26H23N3O3S/c30-26(20-10-13-23(14-11-20)29-16-3-4-17-33(29,31)32)27-22-8-5-7-21(18-22)25-15-12-19-6-1-2-9-24(19)28-25/h1-2,5-15,18H,3-4,16-17H2,(H,27,30) |
| InChIKey | HOVSHWHCBJEPOU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |