C27H29ClN4O3S2 — CID 144621117
2-chloro-N-[4-methyl-3-(1,6-naphthyridin-2-yl)phenyl]-4-(1,3,4-oxathiazinan-4-yl)benzenesulfinamide;ethene;methanol (PubChem CID 144621117) has the molecular formula C27H29ClN4O3S2 and a molecular weight of 557.14 g/mol. Its IUPAC name is 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-2-yl)phenyl]-4-(1,3,4-oxathiazinan-4-yl)benzenesulfinamide;ethene;methanol.
| Compound Name | 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-2-yl)phenyl]-4-(1,3,4-oxathiazinan-4-yl)benzenesulfinamide;ethene;methanol |
|---|---|
| PubChem CID | 144621117 |
| Molecular Formula | C27H29ClN4O3S2 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-2-yl)phenyl]-4-(1,3,4-oxathiazinan-4-yl)benzenesulfinamide;ethene;methanol |
| SMILES | C=C.CO.Cc1ccc(NS(=O)c2ccc(N3CCOCS3)cc2Cl)cc1-c1ccc2cnccc2n1 |
| InChI | InChI=1S/C24H21ClN4O2S2.C2H4.CH4O/c1-16-2-4-18(12-20(16)23-6-3-17-14-26-9-8-22(17)27-23)28-33(30)24-7-5-19(13-21(24)25)29-10-11-31-15-32-29;2*1-2/h2-9,12-14,28H,10-11,15H2,1H3;1-2H2;2H,1H3 |
| InChIKey | DQZYJUQZMFCNHV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|