C24H19Cl3N4O3S — CID 44609705
2,6-dichloro-N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 44609705) has the molecular formula C24H19Cl3N4O3S and a molecular weight of 549.87 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44609705 |
| Molecular Formula | C24H19Cl3N4O3S |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 2,6-dichloro-N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3nccc(N4CCOCC4)c3c2)cnc1Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19Cl3N4O3S/c25-18-2-1-3-19(26)23(18)35(32,33)30-21-13-16(14-29-24(21)27)15-4-5-20-17(12-15)22(6-7-28-20)31-8-10-34-11-9-31/h1-7,12-14,30H,8-11H2 |
| InChIKey | WFCVOUQRRQZXPP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|