C27H31Cl2N3O3S — CID 144621152
3-chlorobenzaldehyde;2-chloro-N-[4-methyl-3-(methylamino)phenyl]-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide;ethane (PubChem CID 144621152) has the molecular formula C27H31Cl2N3O3S and a molecular weight of 548.54 g/mol. Its IUPAC name is 3-chlorobenzaldehyde;2-chloro-N-[4-methyl-3-(methylamino)phenyl]-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide;ethane.
| Compound Name | 3-chlorobenzaldehyde;2-chloro-N-[4-methyl-3-(methylamino)phenyl]-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide;ethane |
|---|---|
| PubChem CID | 144621152 |
| Molecular Formula | C27H31Cl2N3O3S |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 3-chlorobenzaldehyde;2-chloro-N-[4-methyl-3-(methylamino)phenyl]-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide;ethane |
| SMILES | CC.CNc1cc(NC(=O)c2ccc(N3CCCS3=O)cc2Cl)ccc1C.O=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O2S.C7H5ClO.C2H6/c1-12-4-5-13(10-17(12)20-2)21-18(23)15-7-6-14(11-16(15)19)22-8-3-9-25(22)24;8-7-3-1-2-6(4-7)5-9;1-2/h4-7,10-11,20H,3,8-9H2,1-2H3,(H,21,23);1-5H;1-2H3 |
| InChIKey | XCOYMISFFPMPDY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|