C23H19ClFN3O3S — CID 144621473
N-(3-benzamido-4-chlorophenyl)-2-fluoro-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 144621473) has the molecular formula C23H19ClFN3O3S and a molecular weight of 471.94 g/mol. Its IUPAC name is N-(3-benzamido-4-chlorophenyl)-2-fluoro-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(3-benzamido-4-chlorophenyl)-2-fluoro-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 144621473 |
| Molecular Formula | C23H19ClFN3O3S |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-(3-benzamido-4-chlorophenyl)-2-fluoro-4-(1-oxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1cc(NC(=O)c2ccc(N3CCCS3=O)cc2F)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H19ClFN3O3S/c24-19-10-7-16(13-21(19)27-22(29)15-5-2-1-3-6-15)26-23(30)18-9-8-17(14-20(18)25)28-11-4-12-32(28)31/h1-3,5-10,13-14H,4,11-12H2,(H,26,30)(H,27,29) |
| InChIKey | FJFFHKDLLOSJBP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |