C25H21ClN4O2S — CID 144620837
N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(1-oxothiazinan-2-yl)benzamide (PubChem CID 144620837) has the molecular formula C25H21ClN4O2S and a molecular weight of 476.99 g/mol. Its IUPAC name is N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(1-oxothiazinan-2-yl)benzamide.
| Compound Name | N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(1-oxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 144620837 |
| Molecular Formula | C25H21ClN4O2S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(1-oxothiazinan-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2cnc3ccccc3n2)c1)c1ccc(N2CCCCS2=O)cc1 |
| InChI | InChI=1S/C25H21ClN4O2S/c26-21-12-9-18(15-20(21)24-16-27-22-5-1-2-6-23(22)29-24)28-25(31)17-7-10-19(11-8-17)30-13-3-4-14-33(30)32/h1-2,5-12,15-16H,3-4,13-14H2,(H,28,31) |
| InChIKey | PSLVICAFKWXAOY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |