C31H39Cl2N5OS — CID 144621179
butane;2-chloro-N-[4-chloro-3-[[[2-(methylideneamino)phenyl]methylideneamino]methyl]phenyl]-4-[ethyl-[ethyl(methyl)amino]sulfanylamino]benzamide (PubChem CID 144621179) has the molecular formula C31H39Cl2N5OS and a molecular weight of 600.66 g/mol. Its IUPAC name is butane;2-chloro-N-[4-chloro-3-[[[2-(methylideneamino)phenyl]methylideneamino]methyl]phenyl]-4-[ethyl-[ethyl(methyl)amino]sulfanylamino]benzamide.
| Compound Name | butane;2-chloro-N-[4-chloro-3-[[[2-(methylideneamino)phenyl]methylideneamino]methyl]phenyl]-4-[ethyl-[ethyl(methyl)amino]sulfanylamino]benzamide |
|---|---|
| PubChem CID | 144621179 |
| Molecular Formula | C31H39Cl2N5OS |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | butane;2-chloro-N-[4-chloro-3-[[[2-(methylideneamino)phenyl]methylideneamino]methyl]phenyl]-4-[ethyl-[ethyl(methyl)amino]sulfanylamino]benzamide |
| SMILES | C=Nc1ccccc1/C=N/Cc1cc(NC(=O)c2ccc(N(CC)SN(C)CC)cc2Cl)ccc1Cl.CCCC |
| InChI | InChI=1S/C27H29Cl2N5OS.C4H10/c1-5-33(4)36-34(6-2)22-12-13-23(25(29)16-22)27(35)32-21-11-14-24(28)20(15-21)18-31-17-19-9-7-8-10-26(19)30-3;1-3-4-2/h7-17H,3,5-6,18H2,1-2,4H3,(H,32,35);3-4H2,1-2H3/b31-17+; |
| InChIKey | HEAVGRSNFBAENQ-DCJTZURGSA-N |
| XLogP | 9.34 |
| TPSA | 60.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|