C26H33FN8O — CID 144622269
5-[(E)-but-2-enyl]-N-[(Z,3E)-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(2-methylpiperazin-1-yl)prop-1-enyl]-1H-pyrazol-3-amine (PubChem CID 144622269) has the molecular formula C26H33FN8O and a molecular weight of 492.60 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-N-[(Z,3E)-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(2-methylpiperazin-1-yl)prop-1-enyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[(E)-but-2-enyl]-N-[(Z,3E)-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(2-methylpiperazin-1-yl)prop-1-enyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 144622269 |
| Molecular Formula | C26H33FN8O |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 5-[(E)-but-2-enyl]-N-[(Z,3E)-3-[(4-fluoro-2-methyl-1H-indol-5-yl)oxymethylimino]-1-(methylideneamino)-3-(2-methylpiperazin-1-yl)prop-1-enyl]-1H-pyrazol-3-amine |
| SMILES | C=N/C(=C\C(=N/COc1ccc2[nH]c(C)cc2c1F)N1CCNCC1C)Nc1cc(C/C=C/C)[nH]n1 |
| InChI | InChI=1S/C26H33FN8O/c1-5-6-7-19-13-24(34-33-19)32-23(28-4)14-25(35-11-10-29-15-18(35)3)30-16-36-22-9-8-21-20(26(22)27)12-17(2)31-21/h5-6,8-9,12-14,18,29,31H,4,7,10-11,15-16H2,1-3H3,(H2,32,33,34)/b6-5+,23-14+,30-25+ |
| InChIKey | CLWNTQWTNBYOBA-ZGCXWNJKSA-N |
| XLogP | 4.14 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|