C15H26N4O — CID 144625270
ethene;2-[4-(6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 144625270) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is ethene;2-[4-(6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | ethene;2-[4-(6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 144625270 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | ethene;2-[4-(6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | C=C.CCc1cc(N2CCN(CCO)CC2)nc(C)n1 |
| InChI | InChI=1S/C13H22N4O.C2H4/c1-3-12-10-13(15-11(2)14-12)17-6-4-16(5-7-17)8-9-18;1-2/h10,18H,3-9H2,1-2H3;1-2H2 |
| InChIKey | NHEWXNBNGKUEHN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|