C19H30N6O2 — CID 118687413
N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-[(1E)-3-methoxy-2-methylbuta-1,3-dienyl]ethanimidamide (PubChem CID 118687413) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-[(1E)-3-methoxy-2-methylbuta-1,3-dienyl]ethanimidamide.
| Compound Name | N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-[(1E)-3-methoxy-2-methylbuta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 118687413 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-[(1E)-3-methoxy-2-methylbuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(OC)/C(C)=C/N=C(\C)Nc1cc(N2CCN(CCO)CC2)nc(C)n1 |
| InChI | InChI=1S/C19H30N6O2/c1-14(15(2)27-5)13-20-16(3)21-18-12-19(23-17(4)22-18)25-8-6-24(7-9-25)10-11-26/h12-13,26H,2,6-11H2,1,3-5H3,(H,20,21,22,23)/b14-13+ |
| InChIKey | FLDVWZFHNLOCHQ-BUHFOSPRSA-N |
| XLogP | 1.79 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|