C24H32N6O3S — CID 146210301
(Z)-2-[1-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]ethenylsulfanyl]-N-(2-hydroxy-6-methylphenyl)but-2-enamide (PubChem CID 146210301) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is (Z)-2-[1-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]ethenylsulfanyl]-N-(2-hydroxy-6-methylphenyl)but-2-enamide.
| Compound Name | (Z)-2-[1-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]ethenylsulfanyl]-N-(2-hydroxy-6-methylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 146210301 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (Z)-2-[1-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]ethenylsulfanyl]-N-(2-hydroxy-6-methylphenyl)but-2-enamide |
| SMILES | C=C(Nc1cc(N2CCN(CCO)CC2)nc(C)n1)S/C(=C\C)C(=O)Nc1c(C)cccc1O |
| InChI | InChI=1S/C24H32N6O3S/c1-5-20(24(33)28-23-16(2)7-6-8-19(23)32)34-18(4)27-21-15-22(26-17(3)25-21)30-11-9-29(10-12-30)13-14-31/h5-8,15,31-32H,4,9-14H2,1-3H3,(H,28,33)(H,25,26,27)/b20-5- |
| InChIKey | AHSCPUYMRSTJQJ-SDPNRITHSA-N |
| XLogP | 3.07 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|