C24H34ClN7O2S — CID 143457061
[3-[[(1Z,3Z)-2-chloro-6-methylhepta-1,3,5-trienyl]amino]-3-oxoprop-1-en-2-yl] N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-methylcarbamimidothioate (PubChem CID 143457061) has the molecular formula C24H34ClN7O2S and a molecular weight of 520.10 g/mol. Its IUPAC name is [3-[[(1Z,3Z)-2-chloro-6-methylhepta-1,3,5-trienyl]amino]-3-oxoprop-1-en-2-yl] N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-methylcarbamimidothioate.
| Compound Name | [3-[[(1Z,3Z)-2-chloro-6-methylhepta-1,3,5-trienyl]amino]-3-oxoprop-1-en-2-yl] N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 143457061 |
| Molecular Formula | C24H34ClN7O2S |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | [3-[[(1Z,3Z)-2-chloro-6-methylhepta-1,3,5-trienyl]amino]-3-oxoprop-1-en-2-yl] N-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]-N'-methylcarbamimidothioate |
| SMILES | C=C(S/C(=N\C)Nc1cc(N2CCN(CCO)CC2)nc(C)n1)C(=O)N/C=C(Cl)/C=C\C=C(C)C |
| InChI | InChI=1S/C24H34ClN7O2S/c1-17(2)7-6-8-20(25)16-27-23(34)18(3)35-24(26-5)30-21-15-22(29-19(4)28-21)32-11-9-31(10-12-32)13-14-33/h6-8,15-16,33H,3,9-14H2,1-2,4-5H3,(H,27,34)(H,26,28,29,30)/b8-6-,20-16- |
| InChIKey | ZANWINFCVZGGJE-LBGFYQSCSA-N |
| XLogP | 3.26 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|