C32H33F2N5O4 — CID 144625947
tert-butyl 4-[7-[2-fluoro-4-(methylamino)benzoyl]quinoxalin-2-yl]piperazine-1-carboxylate;3-fluorobenzaldehyde (PubChem CID 144625947) has the molecular formula C32H33F2N5O4 and a molecular weight of 589.64 g/mol. Its IUPAC name is tert-butyl 4-[7-[2-fluoro-4-(methylamino)benzoyl]quinoxalin-2-yl]piperazine-1-carboxylate;3-fluorobenzaldehyde.
| Compound Name | tert-butyl 4-[7-[2-fluoro-4-(methylamino)benzoyl]quinoxalin-2-yl]piperazine-1-carboxylate;3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 144625947 |
| Molecular Formula | C32H33F2N5O4 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | tert-butyl 4-[7-[2-fluoro-4-(methylamino)benzoyl]quinoxalin-2-yl]piperazine-1-carboxylate;3-fluorobenzaldehyde |
| SMILES | CNc1ccc(C(=O)c2ccc3ncc(N4CCN(C(=O)OC(C)(C)C)CC4)nc3c2)c(F)c1.O=Cc1cccc(F)c1 |
| InChI | InChI=1S/C25H28FN5O3.C7H5FO/c1-25(2,3)34-24(33)31-11-9-30(10-12-31)22-15-28-20-8-5-16(13-21(20)29-22)23(32)18-7-6-17(27-4)14-19(18)26;8-7-3-1-2-6(4-7)5-9/h5-8,13-15,27H,9-12H2,1-4H3;1-5H |
| InChIKey | WZHFNWXTLCYBGO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|