C16H26N2O2S — CID 144626110
N-[2-(2-ethylphenyl)ethyl]-4-hydroxy-2-methyl-5-(sulfanylamino)pentanamide (PubChem CID 144626110) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-[2-(2-ethylphenyl)ethyl]-4-hydroxy-2-methyl-5-(sulfanylamino)pentanamide.
| Compound Name | N-[2-(2-ethylphenyl)ethyl]-4-hydroxy-2-methyl-5-(sulfanylamino)pentanamide |
|---|---|
| PubChem CID | 144626110 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[2-(2-ethylphenyl)ethyl]-4-hydroxy-2-methyl-5-(sulfanylamino)pentanamide |
| SMILES | CCc1ccccc1CCNC(=O)C(C)CC(O)CNS |
| InChI | InChI=1S/C16H26N2O2S/c1-3-13-6-4-5-7-14(13)8-9-17-16(20)12(2)10-15(19)11-18-21/h4-7,12,15,18-19,21H,3,8-11H2,1-2H3,(H,17,20) |
| InChIKey | ZCQDNKGQPOVDAI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|