C23H31N9O3 — CID 144626878
cyclopropyl-[3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]pyrrolidin-1-yl]methanone;N-(2-hydroxyethyl)formamide (PubChem CID 144626878) has the molecular formula C23H31N9O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is cyclopropyl-[3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]pyrrolidin-1-yl]methanone;N-(2-hydroxyethyl)formamide.
| Compound Name | cyclopropyl-[3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]pyrrolidin-1-yl]methanone;N-(2-hydroxyethyl)formamide |
|---|---|
| PubChem CID | 144626878 |
| Molecular Formula | C23H31N9O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | cyclopropyl-[3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]pyrrolidin-1-yl]methanone;N-(2-hydroxyethyl)formamide |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(NC3CCN(C(=O)C4CC4)C3)ncnc21.O=CNCCO |
| InChI | InChI=1S/C20H24N8O.C3H7NO2/c1-3-28-18(14-8-21-12(2)22-9-14)26-16-17(23-11-24-19(16)28)25-15-6-7-27(10-15)20(29)13-4-5-13;5-2-1-4-3-6/h8-9,11,13,15H,3-7,10H2,1-2H3,(H,23,24,25);3,5H,1-2H2,(H,4,6) |
| InChIKey | NHCOMMBRWPWAPC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 151.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|