C21H25N3O3 — CID 144628735
anisole;N-[5-(2-hydroxypropyl)-4-methyl-2-phenylpyrazol-3-yl]formamide (PubChem CID 144628735) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is anisole;N-[5-(2-hydroxypropyl)-4-methyl-2-phenylpyrazol-3-yl]formamide.
| Compound Name | anisole;N-[5-(2-hydroxypropyl)-4-methyl-2-phenylpyrazol-3-yl]formamide |
|---|---|
| PubChem CID | 144628735 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | anisole;N-[5-(2-hydroxypropyl)-4-methyl-2-phenylpyrazol-3-yl]formamide |
| SMILES | COc1ccccc1.Cc1c(CC(C)O)nn(-c2ccccc2)c1NC=O |
| InChI | InChI=1S/C14H17N3O2.C7H8O/c1-10(19)8-13-11(2)14(15-9-18)17(16-13)12-6-4-3-5-7-12;1-8-7-5-3-2-4-6-7/h3-7,9-10,19H,8H2,1-2H3,(H,15,18);2-6H,1H3 |
| InChIKey | OPJQFQCMXVBMFI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|