C16H23N3O2 — CID 144628837
methanol;3-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]cyclobutan-1-ol (PubChem CID 144628837) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is methanol;3-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]cyclobutan-1-ol.
| Compound Name | methanol;3-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 144628837 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | methanol;3-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]cyclobutan-1-ol |
| SMILES | CNc1c(C)c(C2CC(O)C2)nn1-c1ccccc1.CO |
| InChI | InChI=1S/C15H19N3O.CH4O/c1-10-14(11-8-13(19)9-11)17-18(15(10)16-2)12-6-4-3-5-7-12;1-2/h3-7,11,13,16,19H,8-9H2,1-2H3;2H,1H3 |
| InChIKey | ODASWBJGZIZAFO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |