C19H25N3 — CID 134567678
N,4-dimethyl-3-[(2Z,4E)-octa-2,4-dien-4-yl]-1-phenylpyrazol-5-amine (PubChem CID 134567678) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is N,4-dimethyl-3-[(2Z,4E)-octa-2,4-dien-4-yl]-1-phenylpyrazol-5-amine.
| Compound Name | N,4-dimethyl-3-[(2Z,4E)-octa-2,4-dien-4-yl]-1-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 134567678 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N,4-dimethyl-3-[(2Z,4E)-octa-2,4-dien-4-yl]-1-phenylpyrazol-5-amine |
| SMILES | C/C=C\C(=C/CCC)c1nn(-c2ccccc2)c(NC)c1C |
| InChI | InChI=1S/C19H25N3/c1-5-7-12-16(11-6-2)18-15(3)19(20-4)22(21-18)17-13-9-8-10-14-17/h6,8-14,20H,5,7H2,1-4H3/b11-6-,16-12+ |
| InChIKey | PQUXZDQGSNQJKG-BNBDIBMHSA-N |
| XLogP | 4.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|