C28H36N4O2 — CID 134567506
[3-[(3Z,5E,7Z)-7-(1-cyclobutylethylidene)-8-oxoundeca-3,5-dien-5-yl]-4-methyl-1-phenylpyrazol-5-yl]urea (PubChem CID 134567506) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is [3-[(3Z,5E,7Z)-7-(1-cyclobutylethylidene)-8-oxoundeca-3,5-dien-5-yl]-4-methyl-1-phenylpyrazol-5-yl]urea.
| Compound Name | [3-[(3Z,5E,7Z)-7-(1-cyclobutylethylidene)-8-oxoundeca-3,5-dien-5-yl]-4-methyl-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 134567506 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [3-[(3Z,5E,7Z)-7-(1-cyclobutylethylidene)-8-oxoundeca-3,5-dien-5-yl]-4-methyl-1-phenylpyrazol-5-yl]urea |
| SMILES | CC/C=C\C(=C/C(C(=O)CCC)=C(\C)C1CCC1)c1nn(-c2ccccc2)c(NC(N)=O)c1C |
| InChI | InChI=1S/C28H36N4O2/c1-5-7-13-22(18-24(25(33)12-6-2)19(3)21-14-11-15-21)26-20(4)27(30-28(29)34)32(31-26)23-16-9-8-10-17-23/h7-10,13,16-18,21H,5-6,11-12,14-15H2,1-4H3,(H3,29,30,34)/b13-7-,22-18+,24-19- |
| InChIKey | JTCPOCQTWVDZBW-VBFPWZKISA-N |
| XLogP | 6.51 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|