C18H21N5O2 — CID 145228703
formamide;[4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]-2-pyridinyl]methanol (PubChem CID 145228703) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is formamide;[4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]-2-pyridinyl]methanol.
| Compound Name | formamide;[4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 145228703 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | formamide;[4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]-2-pyridinyl]methanol |
| SMILES | CNc1c(C)c(-c2ccnc(CO)c2)nn1-c1ccccc1.NC=O |
| InChI | InChI=1S/C17H18N4O.CH3NO/c1-12-16(13-8-9-19-14(10-13)11-22)20-21(17(12)18-2)15-6-4-3-5-7-15;2-1-3/h3-10,18,22H,11H2,1-2H3;1H,(H2,2,3) |
| InChIKey | IOSBSQZOVSLQIJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|