C25H42N6O3 — CID 145229102
butane;formamide;4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]oxy-1-(4-methylpiperazin-1-yl)butan-1-one (PubChem CID 145229102) has the molecular formula C25H42N6O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is butane;formamide;4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]oxy-1-(4-methylpiperazin-1-yl)butan-1-one.
| Compound Name | butane;formamide;4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]oxy-1-(4-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 145229102 |
| Molecular Formula | C25H42N6O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | butane;formamide;4-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]oxy-1-(4-methylpiperazin-1-yl)butan-1-one |
| SMILES | CCCC.CNc1c(C)c(OCCCC(=O)N2CCN(C)CC2)nn1-c1ccccc1.NC=O |
| InChI | InChI=1S/C20H29N5O2.C4H10.CH3NO/c1-16-19(21-2)25(17-8-5-4-6-9-17)22-20(16)27-15-7-10-18(26)24-13-11-23(3)12-14-24;1-3-4-2;2-1-3/h4-6,8-9,21H,7,10-15H2,1-3H3;3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | BKZFFFBUURFHQY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|