C18H20N6 — CID 145228930
3-methanimidoyl-N-methyl-5-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]pyridin-2-amine (PubChem CID 145228930) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-methanimidoyl-N-methyl-5-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]pyridin-2-amine.
| Compound Name | 3-methanimidoyl-N-methyl-5-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 145228930 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-methanimidoyl-N-methyl-5-[4-methyl-5-(methylamino)-1-phenylpyrazol-3-yl]pyridin-2-amine |
| SMILES | [H]/N=C/c1cc(-c2nn(-c3ccccc3)c(NC)c2C)cnc1NC |
| InChI | InChI=1S/C18H20N6/c1-12-16(14-9-13(10-19)17(20-2)22-11-14)23-24(18(12)21-3)15-7-5-4-6-8-15/h4-11,19,21H,1-3H3,(H,20,22)/b19-10+ |
| InChIKey | BZPRQOQGZLREKD-VXLYETTFSA-N |
| XLogP | 3.32 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|