C23H27N7O — CID 145228633
N-[3-[5-methanimidoyl-6-[(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-4-methyl-1-phenylpyrazol-5-yl]formamide (PubChem CID 145228633) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is N-[3-[5-methanimidoyl-6-[(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-4-methyl-1-phenylpyrazol-5-yl]formamide.
| Compound Name | N-[3-[5-methanimidoyl-6-[(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-4-methyl-1-phenylpyrazol-5-yl]formamide |
|---|---|
| PubChem CID | 145228633 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[3-[5-methanimidoyl-6-[(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-4-methyl-1-phenylpyrazol-5-yl]formamide |
| SMILES | [H]/N=C/c1cc(-c2nn(-c3ccccc3)c(NC=O)c2C)cnc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C23H27N7O/c1-16-21(28-30(23(16)26-15-31)20-6-4-3-5-7-20)18-12-17(13-24)22(25-14-18)27-19-8-10-29(2)11-9-19/h3-7,12-15,19,24H,8-11H2,1-2H3,(H,25,27)(H,26,31)/b24-13+ |
| InChIKey | JTRQLODNKDQGJJ-ZMOGYAJESA-N |
| XLogP | 3.31 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|