C19H19N5O3 — CID 174766296
phenyl N-[[4-methyl-3-(methylcarbamoyl)-1-phenylpyrazol-5-yl]amino]carbamate (PubChem CID 174766296) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is phenyl N-[[4-methyl-3-(methylcarbamoyl)-1-phenylpyrazol-5-yl]amino]carbamate.
| Compound Name | phenyl N-[[4-methyl-3-(methylcarbamoyl)-1-phenylpyrazol-5-yl]amino]carbamate |
|---|---|
| PubChem CID | 174766296 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | phenyl N-[[4-methyl-3-(methylcarbamoyl)-1-phenylpyrazol-5-yl]amino]carbamate |
| SMILES | CNC(=O)c1nn(-c2ccccc2)c(NNC(=O)Oc2ccccc2)c1C |
| InChI | InChI=1S/C19H19N5O3/c1-13-16(18(25)20-2)23-24(14-9-5-3-6-10-14)17(13)21-22-19(26)27-15-11-7-4-8-12-15/h3-12,21H,1-2H3,(H,20,25)(H,22,26) |
| InChIKey | CAKIXOVYWZGKPF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|