C37H32N2 — CID 144631351
4-[2-(3-carbazol-9-ylphenyl)phenyl]-N-[(3E)-hexa-3,5-dien-3-yl]-N-methylaniline (PubChem CID 144631351) has the molecular formula C37H32N2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 4-[2-(3-carbazol-9-ylphenyl)phenyl]-N-[(3E)-hexa-3,5-dien-3-yl]-N-methylaniline.
| Compound Name | 4-[2-(3-carbazol-9-ylphenyl)phenyl]-N-[(3E)-hexa-3,5-dien-3-yl]-N-methylaniline |
|---|---|
| PubChem CID | 144631351 |
| Molecular Formula | C37H32N2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 4-[2-(3-carbazol-9-ylphenyl)phenyl]-N-[(3E)-hexa-3,5-dien-3-yl]-N-methylaniline |
| SMILES | C=C/C=C(\CC)N(C)c1ccc(-c2ccccc2-c2cccc(-n3c4ccccc4c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C37H32N2/c1-4-13-29(5-2)38(3)30-24-22-27(23-25-30)32-16-6-7-17-33(32)28-14-12-15-31(26-28)39-36-20-10-8-18-34(36)35-19-9-11-21-37(35)39/h4,6-26H,1,5H2,2-3H3/b29-13+ |
| InChIKey | YQISTZPLQVIZTQ-VFLNYLIXSA-N |
| XLogP | 10.03 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|