C46H36N2 — CID 170225174
N-[4-(3-carbazol-9-ylphenyl)cyclohexa-1,3-dien-1-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-naphthalen-1-ylaniline (PubChem CID 170225174) has the molecular formula C46H36N2 and a molecular weight of 616.81 g/mol. Its IUPAC name is N-[4-(3-carbazol-9-ylphenyl)cyclohexa-1,3-dien-1-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-naphthalen-1-ylaniline.
| Compound Name | N-[4-(3-carbazol-9-ylphenyl)cyclohexa-1,3-dien-1-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-naphthalen-1-ylaniline |
|---|---|
| PubChem CID | 170225174 |
| Molecular Formula | C46H36N2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | N-[4-(3-carbazol-9-ylphenyl)cyclohexa-1,3-dien-1-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-naphthalen-1-ylaniline |
| SMILES | C=C/C=C(\C=C)N(C1=CC=C(c2cccc(-n3c4ccccc4c4ccccc43)c2)CC1)c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C46H36N2/c1-3-13-37(4-2)47(39-30-26-35(27-31-39)42-21-12-15-34-14-5-6-18-41(34)42)38-28-24-33(25-29-38)36-16-11-17-40(32-36)48-45-22-9-7-19-43(45)44-20-8-10-23-46(44)48/h3-24,26-28,30-32H,1-2,25,29H2/b37-13+ |
| InChIKey | KNSXNEGCIZGYJC-WMJGVATBSA-N |
| XLogP | 12.43 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|