C18H18ClN3O — CID 144631450
N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-3-(2-chlorophenyl)propanamide (PubChem CID 144631450) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-3-(2-chlorophenyl)propanamide.
| Compound Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-3-(2-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 144631450 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-3-(2-chlorophenyl)propanamide |
| SMILES | [H]/N=C/C(=C\N)c1ccc(NC(=O)CCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O/c19-17-4-2-1-3-14(17)7-10-18(23)22-16-8-5-13(6-9-16)15(11-20)12-21/h1-6,8-9,11-12,20H,7,10,21H2,(H,22,23)/b15-12+,20-11+ |
| InChIKey | LROCQUDXZGLHRD-OWUWXWLISA-N |
| XLogP | 3.86 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|