C12H20O4 — CID 144631543
3-propan-2-yloxy-6-prop-1-en-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 144631543) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-propan-2-yloxy-6-prop-1-en-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | 3-propan-2-yloxy-6-prop-1-en-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 144631543 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-propan-2-yloxy-6-prop-1-en-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C=C(C)OC1COC2C(OC(C)C)COC12 |
| InChI | InChI=1S/C12H20O4/c1-7(2)15-9-5-13-12-10(16-8(3)4)6-14-11(9)12/h8-12H,1,5-6H2,2-4H3 |
| InChIKey | RROINXPNROZURJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|