C14H27NO4 — CID 144632112
acetaldehyde;ethane;[(2E)-8-(methylamino)cyclooct-2-en-1-yl] hydrogen carbonate (PubChem CID 144632112) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is acetaldehyde;ethane;[(2E)-8-(methylamino)cyclooct-2-en-1-yl] hydrogen carbonate.
| Compound Name | acetaldehyde;ethane;[(2E)-8-(methylamino)cyclooct-2-en-1-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 144632112 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | acetaldehyde;ethane;[(2E)-8-(methylamino)cyclooct-2-en-1-yl] hydrogen carbonate |
| SMILES | CC.CC=O.CNC1CCCC/C=C\C1OC(=O)O |
| InChI | InChI=1S/C10H17NO3.C2H4O.C2H6/c1-11-8-6-4-2-3-5-7-9(8)14-10(12)13;1-2-3;1-2/h5,7-9,11H,2-4,6H2,1H3,(H,12,13);2H,1H3;1-2H3/b7-5-;; |
| InChIKey | BKACZVUXHWEBIM-MWKZNRQPSA-N |
| XLogP | 3.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|