C17H21N7O — CID 144632274
N-[[4-[(Z)-N'-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]carbamimidoyl]phenyl]methyl]butanamide (PubChem CID 144632274) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[[4-[(Z)-N'-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]carbamimidoyl]phenyl]methyl]butanamide.
| Compound Name | N-[[4-[(Z)-N'-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]carbamimidoyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 144632274 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[[4-[(Z)-N'-[(Z)-[amino(pyrimidin-2-yl)methylidene]amino]carbamimidoyl]phenyl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1ccc(/C(N)=N/N=C(\N)c2ncccn2)cc1 |
| InChI | InChI=1S/C17H21N7O/c1-2-4-14(25)22-11-12-5-7-13(8-6-12)15(18)23-24-16(19)17-20-9-3-10-21-17/h3,5-10H,2,4,11H2,1H3,(H2,18,23)(H2,19,24)(H,22,25) |
| InChIKey | HXZJZSMDXRRVFV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|