C22H33N6O2Si+ — CID 144632959
2-[[6-[[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]amino]pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium (PubChem CID 144632959) has the molecular formula C22H33N6O2Si+ and a molecular weight of 441.63 g/mol. Its IUPAC name is 2-[[6-[[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]amino]pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium.
| Compound Name | 2-[[6-[[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]amino]pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
|---|---|
| PubChem CID | 144632959 |
| Molecular Formula | C22H33N6O2Si+ |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-[[6-[[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]amino]pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
| SMILES | COC1CCN(c2nccc(Nc3cc4c(ccn4COCC[SiH2+](C)C)cn3)n2)CC1 |
| InChI | InChI=1S/C22H33N6O2Si/c1-29-18-6-10-27(11-7-18)22-23-8-4-20(26-22)25-21-14-19-17(15-24-21)5-9-28(19)16-30-12-13-31(2)3/h4-5,8-9,14-15,18H,6-7,10-13,16,31H2,1-3H3,(H,23,24,25,26)/q+1 |
| InChIKey | PAYXNWFQKPFDRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|