C18H25N7O3 — CID 90177670
2-N-[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]-5-nitro-4-N-propan-2-ylpyridine-2,4-diamine (PubChem CID 90177670) has the molecular formula C18H25N7O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-N-[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]-5-nitro-4-N-propan-2-ylpyridine-2,4-diamine.
| Compound Name | 2-N-[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]-5-nitro-4-N-propan-2-ylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 90177670 |
| Molecular Formula | C18H25N7O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-N-[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]-5-nitro-4-N-propan-2-ylpyridine-2,4-diamine |
| SMILES | COC1CCN(c2nccc(Nc3cc(NC(C)C)c([N+](=O)[O-])cn3)n2)CC1 |
| InChI | InChI=1S/C18H25N7O3/c1-12(2)21-14-10-17(20-11-15(14)25(26)27)22-16-4-7-19-18(23-16)24-8-5-13(28-3)6-9-24/h4,7,10-13H,5-6,8-9H2,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | JEJWWIFLJIFMQL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|