C9H21N3 — CID 144634094
N,N'-dimethylpyrrolidine-2-carboximidamide;ethane (PubChem CID 144634094) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is N,N'-dimethylpyrrolidine-2-carboximidamide;ethane.
| Compound Name | N,N'-dimethylpyrrolidine-2-carboximidamide;ethane |
|---|---|
| PubChem CID | 144634094 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N,N'-dimethylpyrrolidine-2-carboximidamide;ethane |
| SMILES | C/N=C(\NC)C1CCCN1.CC |
| InChI | InChI=1S/C7H15N3.C2H6/c1-8-7(9-2)6-4-3-5-10-6;1-2/h6,10H,3-5H2,1-2H3,(H,8,9);1-2H3 |
| InChIKey | UWASVQXSYJTANR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|