C19H16N2O3Se — CID 144634507
2-[3-cyano-4-(3-methoxyphenyl)phenyl]-4-methyl-2,3-dihydro-1,3-selenazole-5-carboxylic acid (PubChem CID 144634507) has the molecular formula C19H16N2O3Se and a molecular weight of 399.31 g/mol. Its IUPAC name is 2-[3-cyano-4-(3-methoxyphenyl)phenyl]-4-methyl-2,3-dihydro-1,3-selenazole-5-carboxylic acid.
| Compound Name | 2-[3-cyano-4-(3-methoxyphenyl)phenyl]-4-methyl-2,3-dihydro-1,3-selenazole-5-carboxylic acid |
|---|---|
| PubChem CID | 144634507 |
| Molecular Formula | C19H16N2O3Se |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[3-cyano-4-(3-methoxyphenyl)phenyl]-4-methyl-2,3-dihydro-1,3-selenazole-5-carboxylic acid |
| SMILES | COc1cccc(-c2ccc(C3NC(C)=C(C(=O)O)[Se]3)cc2C#N)c1 |
| InChI | InChI=1S/C19H16N2O3Se/c1-11-17(19(22)23)25-18(21-11)13-6-7-16(14(8-13)10-20)12-4-3-5-15(9-12)24-2/h3-9,18,21H,1-2H3,(H,22,23) |
| InChIKey | ZBVQTDQBILKHJR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|