C15H12N2O3S — CID 121333439
5-cyano-4-(3-methoxyphenyl)-2-methyl-6-sulfanylidene-1H-pyridine-3-carboxylic acid (PubChem CID 121333439) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 5-cyano-4-(3-methoxyphenyl)-2-methyl-6-sulfanylidene-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-cyano-4-(3-methoxyphenyl)-2-methyl-6-sulfanylidene-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 121333439 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 5-cyano-4-(3-methoxyphenyl)-2-methyl-6-sulfanylidene-1H-pyridine-3-carboxylic acid |
| SMILES | COc1cccc(-c2c(C(=O)O)c(C)[nH]c(=S)c2C#N)c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-8-12(15(18)19)13(11(7-16)14(21)17-8)9-4-3-5-10(6-9)20-2/h3-6H,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | CWQHHZNDPFCVMK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|