C23H28FN7O3 — CID 144636242
6-[amino-[(Z)-hydrazinylidenemethyl]amino]-N-[3-fluoro-1-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 144636242) has the molecular formula C23H28FN7O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is 6-[amino-[(Z)-hydrazinylidenemethyl]amino]-N-[3-fluoro-1-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-[amino-[(Z)-hydrazinylidenemethyl]amino]-N-[3-fluoro-1-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144636242 |
| Molecular Formula | C23H28FN7O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 6-[amino-[(Z)-hydrazinylidenemethyl]amino]-N-[3-fluoro-1-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1c(CCN2CCC(NC(=O)c3ccc(N(N)/C=N\N)nc3)C(F)C2)ccc2c1COC2=O |
| InChI | InChI=1S/C23H28FN7O3/c1-14-15(2-4-17-18(14)12-34-23(17)33)6-8-30-9-7-20(19(24)11-30)29-22(32)16-3-5-21(27-10-16)31(26)13-28-25/h2-5,10,13,19-20H,6-9,11-12,25-26H2,1H3,(H,29,32)/b28-13- |
| InChIKey | ACFXTEYSSLVACB-QDTIIGTASA-N |
| XLogP | 1.03 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|