C28H31IN4O — CID 144636322
5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-imine (PubChem CID 144636322) has the molecular formula C28H31IN4O and a molecular weight of 566.49 g/mol. Its IUPAC name is 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-imine.
| Compound Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 144636322 |
| Molecular Formula | C28H31IN4O |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-imine |
| SMILES | [H]/N=C1\OC(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)CN1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C28H31IN4O/c29-25-13-11-22(12-14-25)19-33-21-26(34-28(33)30)20-31-15-17-32(18-16-31)27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,26-27,30H,15-21H2/b30-28- |
| InChIKey | VXYCYBIYMYNNOO-HYOGKJQXSA-N |
| XLogP | 4.83 |
| TPSA | 42.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|