C15H21NO4S — CID 144638715
3-(cyclopropylmethoxy)-4-[2-(dimethylamino)ethylsulfanyloxy]benzoic acid (PubChem CID 144638715) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4-[2-(dimethylamino)ethylsulfanyloxy]benzoic acid.
| Compound Name | 3-(cyclopropylmethoxy)-4-[2-(dimethylamino)ethylsulfanyloxy]benzoic acid |
|---|---|
| PubChem CID | 144638715 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-[2-(dimethylamino)ethylsulfanyloxy]benzoic acid |
| SMILES | CN(C)CCSOc1ccc(C(=O)O)cc1OCC1CC1 |
| InChI | InChI=1S/C15H21NO4S/c1-16(2)7-8-21-20-13-6-5-12(15(17)18)9-14(13)19-10-11-3-4-11/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,17,18) |
| InChIKey | ZUNMWUDKASBATH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|