C16H24N2O4S — CID 144638721
4-[2-(dimethylamino)ethylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid (PubChem CID 144638721) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid.
| Compound Name | 4-[2-(dimethylamino)ethylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 144638721 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[2-(dimethylamino)ethylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid |
| SMILES | CN(C)CCSN(C(=O)OC(C)(C)C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,3)22-15(21)18(23-11-10-17(4)5)13-8-6-12(7-9-13)14(19)20/h6-9H,10-11H2,1-5H3,(H,19,20) |
| InChIKey | UOEKTRYRGPOUGI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|