C31H59N3O5 — CID 144639241
(2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydroxy-7-[(3-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2-propan-2-ylnonanamide;ethane (PubChem CID 144639241) has the molecular formula C31H59N3O5 and a molecular weight of 553.83 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydroxy-7-[(3-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2-propan-2-ylnonanamide;ethane.
| Compound Name | (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydroxy-7-[(3-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2-propan-2-ylnonanamide;ethane |
|---|---|
| PubChem CID | 144639241 |
| Molecular Formula | C31H59N3O5 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.45 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydroxy-7-[(3-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2-propan-2-ylnonanamide;ethane |
| SMILES | CC.CC.CNC(=O)C(C)(C)CNC(=O)C(C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OC)c(O)c1)C(C)C)C(C)C |
| InChI | InChI=1S/C27H47N3O5.2C2H6/c1-16(2)19(11-18-9-10-24(35-8)23(32)12-18)13-21(28)22(31)14-20(17(3)4)25(33)30-15-27(5,6)26(34)29-7;2*1-2/h9-10,12,16-17,19-22,31-32H,11,13-15,28H2,1-8H3,(H,29,34)(H,30,33);2*1-2H3/t19-,20?,21-,22-;;/m0../s1 |
| InChIKey | BGOZNQXUSPYSNF-INGNYEPCSA-N |
| XLogP | 4.90 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |