C62H59N — CID 144640095
ethane;2-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-9,9-dimethylfluorene;3-[(E)-2-[3-(4-methylphenyl)phenyl]ethenyl]-1-(4-phenylphenyl)-2-[(Z)-prop-1-enyl]indole (PubChem CID 144640095) has the molecular formula C62H59N and a molecular weight of 818.16 g/mol. Its IUPAC name is ethane;2-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-9,9-dimethylfluorene;3-[(E)-2-[3-(4-methylphenyl)phenyl]ethenyl]-1-(4-phenylphenyl)-2-[(Z)-prop-1-enyl]indole.
| Compound Name | ethane;2-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-9,9-dimethylfluorene;3-[(E)-2-[3-(4-methylphenyl)phenyl]ethenyl]-1-(4-phenylphenyl)-2-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 144640095 |
| Molecular Formula | C62H59N |
| Molecular Weight | 818.16 g/mol |
| Exact Mass | 817.46 |
| IUPAC Name | ethane;2-[(1Z,3Z,5E)-hepta-1,3,5-trienyl]-9,9-dimethylfluorene;3-[(E)-2-[3-(4-methylphenyl)phenyl]ethenyl]-1-(4-phenylphenyl)-2-[(Z)-prop-1-enyl]indole |
| SMILES | C/C=C/C=C\C=C/c1ccc2c(c1)C(C)(C)c1ccccc1-2.C/C=C\c1c(/C=C/c2cccc(-c3ccc(C)cc3)c2)c2ccccc2n1-c1ccc(-c2ccccc2)cc1.CC |
| InChI | InChI=1S/C38H31N.C22H22.C2H6/c1-3-10-37-36(26-19-29-11-9-14-33(27-29)32-20-17-28(2)18-21-32)35-15-7-8-16-38(35)39(37)34-24-22-31(23-25-34)30-12-5-4-6-13-30;1-4-5-6-7-8-11-17-14-15-19-18-12-9-10-13-20(18)22(2,3)21(19)16-17;1-2/h3-27H,1-2H3;4-16H,1-3H3;1-2H3/b10-3-,26-19+;5-4+,7-6-,11-8-; |
| InChIKey | HJJVJJDPQWJZGX-LDCRKDBYSA-N |
| XLogP | 17.64 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.16 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|