C10H17N — CID 144640443
1,2,3,4,6,7-hexahydroquinoline;methane (PubChem CID 144640443) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexahydroquinoline;methane.
| Compound Name | 1,2,3,4,6,7-hexahydroquinoline;methane |
|---|---|
| PubChem CID | 144640443 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1,2,3,4,6,7-hexahydroquinoline;methane |
| SMILES | C.C1=C2CCCNC2=CCC1 |
| InChI | InChI=1S/C9H13N.CH4/c1-2-6-9-8(4-1)5-3-7-10-9;/h4,6,10H,1-3,5,7H2;1H4 |
| InChIKey | FXTRRHSODZASKY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |