C55H111NO6 — CID 144641560
nonadecan-10-yl 4-(diethylamino)butanoate;bis(3-pentyloctyl formate) (PubChem CID 144641560) has the molecular formula C55H111NO6 and a molecular weight of 882.49 g/mol. Its IUPAC name is nonadecan-10-yl 4-(diethylamino)butanoate;bis(3-pentyloctyl formate).
| Compound Name | nonadecan-10-yl 4-(diethylamino)butanoate;bis(3-pentyloctyl formate) |
|---|---|
| PubChem CID | 144641560 |
| Molecular Formula | C55H111NO6 |
| Molecular Weight | 882.49 g/mol |
| Exact Mass | 881.84 |
| IUPAC Name | nonadecan-10-yl 4-(diethylamino)butanoate;bis(3-pentyloctyl formate) |
| SMILES | CCCCCC(CCCCC)CCOC=O.CCCCCC(CCCCC)CCOC=O.CCCCCCCCCC(CCCCCCCCC)OC(=O)CCCN(CC)CC |
| InChI | InChI=1S/C27H55NO2.2C14H28O2/c1-5-9-11-13-15-17-19-22-26(23-20-18-16-14-12-10-6-2)30-27(29)24-21-25-28(7-3)8-4;2*1-3-5-7-9-14(10-8-6-4-2)11-12-16-13-15/h26H,5-25H2,1-4H3;2*13-14H,3-12H2,1-2H3 |
| InChIKey | WJBRVZVOCMWJJK-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.49 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|