C14H16O4S — CID 14464209
(Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-phenylsulfanylprop-2-en-1-one (PubChem CID 14464209) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is (Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-phenylsulfanylprop-2-en-1-one.
| Compound Name | (Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-phenylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 14464209 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-phenylsulfanylprop-2-en-1-one |
| SMILES | CC1(C)OC[C@@H](C(=O)/C(=C/O)Sc2ccccc2)O1 |
| InChI | InChI=1S/C14H16O4S/c1-14(2)17-9-11(18-14)13(16)12(8-15)19-10-6-4-3-5-7-10/h3-8,11,15H,9H2,1-2H3/b12-8-/t11-/m0/s1 |
| InChIKey | LXIWULVBMITYPS-LCFDYFRESA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|