C16H18O5S — CID 14464210
[(Z)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxo-2-phenylsulfanylprop-1-enyl] acetate (PubChem CID 14464210) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is [(Z)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxo-2-phenylsulfanylprop-1-enyl] acetate.
| Compound Name | [(Z)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxo-2-phenylsulfanylprop-1-enyl] acetate |
|---|---|
| PubChem CID | 14464210 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [(Z)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxo-2-phenylsulfanylprop-1-enyl] acetate |
| SMILES | CC(=O)O/C=C(\Sc1ccccc1)C(=O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C16H18O5S/c1-11(17)19-10-14(22-12-7-5-4-6-8-12)15(18)13-9-20-16(2,3)21-13/h4-8,10,13H,9H2,1-3H3/b14-10- |
| InChIKey | SWRUPXWSNYWEJK-UVTDQMKNSA-N |
| XLogP | 2.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|