C19H20O3S2 — CID 11142930
1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-bis(phenylsulfanyl)ethanone (PubChem CID 11142930) has the molecular formula C19H20O3S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-bis(phenylsulfanyl)ethanone.
| Compound Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-bis(phenylsulfanyl)ethanone |
|---|---|
| PubChem CID | 11142930 |
| Molecular Formula | C19H20O3S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-bis(phenylsulfanyl)ethanone |
| SMILES | CC1(C)OCC(C(=O)C(Sc2ccccc2)Sc2ccccc2)O1 |
| InChI | InChI=1S/C19H20O3S2/c1-19(2)21-13-16(22-19)17(20)18(23-14-9-5-3-6-10-14)24-15-11-7-4-8-12-15/h3-12,16,18H,13H2,1-2H3 |
| InChIKey | BWSZJABRCFLZQP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|